C14H22O7S — CID 74039305
(7-acetyloxy-2-ethylsulfanyl-2,5-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-yl) acetate (PubChem CID 74039305) has the molecular formula C14H22O7S and a molecular weight of 334.39 g/mol. Its IUPAC name is (7-acetyloxy-2-ethylsulfanyl-2,5-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-yl) acetate.
| Compound Name | (7-acetyloxy-2-ethylsulfanyl-2,5-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-yl) acetate |
|---|---|
| PubChem CID | 74039305 |
| Molecular Formula | C14H22O7S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | (7-acetyloxy-2-ethylsulfanyl-2,5-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-yl) acetate |
| SMILES | CCSC1(C)OC2OC(C)C(OC(C)=O)C(OC(C)=O)C2O1 |
| InChI | InChI=1S/C14H22O7S/c1-6-22-14(5)20-12-11(19-9(4)16)10(18-8(3)15)7(2)17-13(12)21-14/h7,10-13H,6H2,1-5H3 |
| InChIKey | FZYJWLWTSCVRBN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |