C11H20O4S — CID 134855169
[(4R,6S)-6-ethylsulfanyl-4-methoxy-2-methyloxan-3-yl] acetate (PubChem CID 134855169) has the molecular formula C11H20O4S and a molecular weight of 248.34 g/mol. Its IUPAC name is [(4R,6S)-6-ethylsulfanyl-4-methoxy-2-methyloxan-3-yl] acetate.
| Compound Name | [(4R,6S)-6-ethylsulfanyl-4-methoxy-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 134855169 |
| Molecular Formula | C11H20O4S |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | [(4R,6S)-6-ethylsulfanyl-4-methoxy-2-methyloxan-3-yl] acetate |
| SMILES | CCS[C@H]1C[C@@H](OC)C(OC(C)=O)C(C)O1 |
| InChI | InChI=1S/C11H20O4S/c1-5-16-10-6-9(13-4)11(7(2)14-10)15-8(3)12/h7,9-11H,5-6H2,1-4H3/t7?,9-,10+,11?/m1/s1 |
| InChIKey | RMQZOIFBHXLOMT-ONJAQYSBSA-N |
| XLogP | 1.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |