C13H22O5S — CID 11644981
[(3aR,4S,6R,7S,7aR)-6-ethylsulfanyl-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate (PubChem CID 11644981) has the molecular formula C13H22O5S and a molecular weight of 290.38 g/mol. Its IUPAC name is [(3aR,4S,6R,7S,7aR)-6-ethylsulfanyl-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate.
| Compound Name | [(3aR,4S,6R,7S,7aR)-6-ethylsulfanyl-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
|---|---|
| PubChem CID | 11644981 |
| Molecular Formula | C13H22O5S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | [(3aR,4S,6R,7S,7aR)-6-ethylsulfanyl-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
| SMILES | CCS[C@H]1O[C@@H](C)[C@H]2OC(C)(C)O[C@H]2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H22O5S/c1-6-19-12-11(16-8(3)14)10-9(7(2)15-12)17-13(4,5)18-10/h7,9-12H,6H2,1-5H3/t7-,9+,10+,11-,12+/m0/s1 |
| InChIKey | GJBMQPJLKOBPMZ-VSYPEIIYSA-N |
| XLogP | 1.94 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |