C14H24O5S — CID 16757203
[(3aR,4S,6S,7S,7aR)-2,2,6-trimethyl-4-propan-2-ylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate (PubChem CID 16757203) has the molecular formula C14H24O5S and a molecular weight of 304.41 g/mol. Its IUPAC name is [(3aR,4S,6S,7S,7aR)-2,2,6-trimethyl-4-propan-2-ylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate.
| Compound Name | [(3aR,4S,6S,7S,7aR)-2,2,6-trimethyl-4-propan-2-ylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
|---|---|
| PubChem CID | 16757203 |
| Molecular Formula | C14H24O5S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | [(3aR,4S,6S,7S,7aR)-2,2,6-trimethyl-4-propan-2-ylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@H](SC(C)C)O[C@H]1C |
| InChI | InChI=1S/C14H24O5S/c1-7(2)20-13-12-11(18-14(5,6)19-12)10(8(3)16-13)17-9(4)15/h7-8,10-13H,1-6H3/t8-,10-,11+,12+,13-/m0/s1 |
| InChIKey | YUUOTTCAXGXIGJ-FXAPSIEYSA-N |
| XLogP | 2.32 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |