C17H22N4O4 — CID 109343225
N-(2,5-dimethoxyphenyl)-6-(3-methoxypropylamino)pyrimidine-4-carboxamide (PubChem CID 109343225) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-6-(3-methoxypropylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-6-(3-methoxypropylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109343225 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-6-(3-methoxypropylamino)pyrimidine-4-carboxamide |
| SMILES | COCCCNc1cc(C(=O)Nc2cc(OC)ccc2OC)ncn1 |
| InChI | InChI=1S/C17H22N4O4/c1-23-8-4-7-18-16-10-14(19-11-20-16)17(22)21-13-9-12(24-2)5-6-15(13)25-3/h5-6,9-11H,4,7-8H2,1-3H3,(H,21,22)(H,18,19,20) |
| InChIKey | LPJQTYVVQROAHP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|