C18H19N5O4 — CID 109353668
6-[2-(4-methoxyphenoxy)ethylamino]-N-(5-methyl-1,2-oxazol-3-yl)pyrimidine-4-carboxamide (PubChem CID 109353668) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is 6-[2-(4-methoxyphenoxy)ethylamino]-N-(5-methyl-1,2-oxazol-3-yl)pyrimidine-4-carboxamide.
| Compound Name | 6-[2-(4-methoxyphenoxy)ethylamino]-N-(5-methyl-1,2-oxazol-3-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109353668 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 6-[2-(4-methoxyphenoxy)ethylamino]-N-(5-methyl-1,2-oxazol-3-yl)pyrimidine-4-carboxamide |
| SMILES | COc1ccc(OCCNc2cc(C(=O)Nc3cc(C)on3)ncn2)cc1 |
| InChI | InChI=1S/C18H19N5O4/c1-12-9-17(23-27-12)22-18(24)15-10-16(21-11-20-15)19-7-8-26-14-5-3-13(25-2)4-6-14/h3-6,9-11H,7-8H2,1-2H3,(H,19,20,21)(H,22,23,24) |
| InChIKey | PDNCAHYEOIQODU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 111.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|