C16H15N5O2 — CID 109346618
6-(benzylamino)-N-(5-methyl-1,2-oxazol-3-yl)pyrimidine-4-carboxamide (PubChem CID 109346618) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 6-(benzylamino)-N-(5-methyl-1,2-oxazol-3-yl)pyrimidine-4-carboxamide.
| Compound Name | 6-(benzylamino)-N-(5-methyl-1,2-oxazol-3-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109346618 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 6-(benzylamino)-N-(5-methyl-1,2-oxazol-3-yl)pyrimidine-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cc(NCc3ccccc3)ncn2)no1 |
| InChI | InChI=1S/C16H15N5O2/c1-11-7-15(21-23-11)20-16(22)13-8-14(19-10-18-13)17-9-12-5-3-2-4-6-12/h2-8,10H,9H2,1H3,(H,17,18,19)(H,20,21,22) |
| InChIKey | UAGWPOUNQSSDFC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |