C17H20N6O2 — CID 109346006
1-[4-[6-(pyridin-3-ylmethylamino)pyrimidine-4-carbonyl]piperazin-1-yl]ethanone (PubChem CID 109346006) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 1-[4-[6-(pyridin-3-ylmethylamino)pyrimidine-4-carbonyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[6-(pyridin-3-ylmethylamino)pyrimidine-4-carbonyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 109346006 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[4-[6-(pyridin-3-ylmethylamino)pyrimidine-4-carbonyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)c2cc(NCc3cccnc3)ncn2)CC1 |
| InChI | InChI=1S/C17H20N6O2/c1-13(24)22-5-7-23(8-6-22)17(25)15-9-16(21-12-20-15)19-11-14-3-2-4-18-10-14/h2-4,9-10,12H,5-8,11H2,1H3,(H,19,20,21) |
| InChIKey | VRVYDAUGRHMMIX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |