C21H23N7O — CID 109347052
[6-[(3-methylphenyl)methylamino]pyrimidin-4-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 109347052) has the molecular formula C21H23N7O and a molecular weight of 389.46 g/mol. Its IUPAC name is [6-[(3-methylphenyl)methylamino]pyrimidin-4-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [6-[(3-methylphenyl)methylamino]pyrimidin-4-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109347052 |
| Molecular Formula | C21H23N7O |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | [6-[(3-methylphenyl)methylamino]pyrimidin-4-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | Cc1cccc(CNc2cc(C(=O)N3CCN(c4ncccn4)CC3)ncn2)c1 |
| InChI | InChI=1S/C21H23N7O/c1-16-4-2-5-17(12-16)14-24-19-13-18(25-15-26-19)20(29)27-8-10-28(11-9-27)21-22-6-3-7-23-21/h2-7,12-13,15H,8-11,14H2,1H3,(H,24,25,26) |
| InChIKey | GIRXMMWKJFIMFV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |