C16H12Cl2N4O2 — CID 109346451
6-(2,3-dichloroanilino)-N-(furan-2-ylmethyl)pyrimidine-4-carboxamide (PubChem CID 109346451) has the molecular formula C16H12Cl2N4O2 and a molecular weight of 363.20 g/mol. Its IUPAC name is 6-(2,3-dichloroanilino)-N-(furan-2-ylmethyl)pyrimidine-4-carboxamide.
| Compound Name | 6-(2,3-dichloroanilino)-N-(furan-2-ylmethyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109346451 |
| Molecular Formula | C16H12Cl2N4O2 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 6-(2,3-dichloroanilino)-N-(furan-2-ylmethyl)pyrimidine-4-carboxamide |
| SMILES | O=C(NCc1ccco1)c1cc(Nc2cccc(Cl)c2Cl)ncn1 |
| InChI | InChI=1S/C16H12Cl2N4O2/c17-11-4-1-5-12(15(11)18)22-14-7-13(20-9-21-14)16(23)19-8-10-3-2-6-24-10/h1-7,9H,8H2,(H,19,23)(H,20,21,22) |
| InChIKey | JHYDATGOUHRELE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |