C18H13Cl2FN4O — CID 109348243
6-(2,3-dichloroanilino)-N-[(2-fluorophenyl)methyl]pyrimidine-4-carboxamide (PubChem CID 109348243) has the molecular formula C18H13Cl2FN4O and a molecular weight of 391.23 g/mol. Its IUPAC name is 6-(2,3-dichloroanilino)-N-[(2-fluorophenyl)methyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(2,3-dichloroanilino)-N-[(2-fluorophenyl)methyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109348243 |
| Molecular Formula | C18H13Cl2FN4O |
| Molecular Weight | 391.23 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 6-(2,3-dichloroanilino)-N-[(2-fluorophenyl)methyl]pyrimidine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1F)c1cc(Nc2cccc(Cl)c2Cl)ncn1 |
| InChI | InChI=1S/C18H13Cl2FN4O/c19-12-5-3-7-14(17(12)20)25-16-8-15(23-10-24-16)18(26)22-9-11-4-1-2-6-13(11)21/h1-8,10H,9H2,(H,22,26)(H,23,24,25) |
| InChIKey | AGVWJFWXUQKRIW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.23 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |