C16H18O2S — CID 10934650
[1-(1-phenylsulfanylpropa-1,2-dienyl)cyclopentyl] acetate (PubChem CID 10934650) has the molecular formula C16H18O2S and a molecular weight of 274.38 g/mol. Its IUPAC name is [1-(1-phenylsulfanylpropa-1,2-dienyl)cyclopentyl] acetate.
| Compound Name | [1-(1-phenylsulfanylpropa-1,2-dienyl)cyclopentyl] acetate |
|---|---|
| PubChem CID | 10934650 |
| Molecular Formula | C16H18O2S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | [1-(1-phenylsulfanylpropa-1,2-dienyl)cyclopentyl] acetate |
| SMILES | C=C=C(Sc1ccccc1)C1(OC(C)=O)CCCC1 |
| InChI | InChI=1S/C16H18O2S/c1-3-15(19-14-9-5-4-6-10-14)16(18-13(2)17)11-7-8-12-16/h4-6,9-10H,1,7-8,11-12H2,2H3 |
| InChIKey | GLBSOZQXDGNPNT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |