C18H24N4O — CID 109354322
6-(N-ethylanilino)-N-(3-methylbutyl)pyrimidine-4-carboxamide (PubChem CID 109354322) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 6-(N-ethylanilino)-N-(3-methylbutyl)pyrimidine-4-carboxamide.
| Compound Name | 6-(N-ethylanilino)-N-(3-methylbutyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109354322 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 6-(N-ethylanilino)-N-(3-methylbutyl)pyrimidine-4-carboxamide |
| SMILES | CCN(c1ccccc1)c1cc(C(=O)NCCC(C)C)ncn1 |
| InChI | InChI=1S/C18H24N4O/c1-4-22(15-8-6-5-7-9-15)17-12-16(20-13-21-17)18(23)19-11-10-14(2)3/h5-9,12-14H,4,10-11H2,1-3H3,(H,19,23) |
| InChIKey | PNNXTHMJUMXPDH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |