C17H24N4 — CID 112864003
4-N-ethyl-6-N-(3-methylbutyl)-4-N-phenylpyrimidine-4,6-diamine (PubChem CID 112864003) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-N-ethyl-6-N-(3-methylbutyl)-4-N-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N-ethyl-6-N-(3-methylbutyl)-4-N-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112864003 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-N-ethyl-6-N-(3-methylbutyl)-4-N-phenylpyrimidine-4,6-diamine |
| SMILES | CCN(c1ccccc1)c1cc(NCCC(C)C)ncn1 |
| InChI | InChI=1S/C17H24N4/c1-4-21(15-8-6-5-7-9-15)17-12-16(19-13-20-17)18-11-10-14(2)3/h5-9,12-14H,4,10-11H2,1-3H3,(H,18,19,20) |
| InChIKey | FPMBQXWUICGEPV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |