C17H18N4O — CID 112858629
4-N-ethyl-6-N-(furan-2-ylmethyl)-4-N-phenylpyrimidine-4,6-diamine (PubChem CID 112858629) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 4-N-ethyl-6-N-(furan-2-ylmethyl)-4-N-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N-ethyl-6-N-(furan-2-ylmethyl)-4-N-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112858629 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 4-N-ethyl-6-N-(furan-2-ylmethyl)-4-N-phenylpyrimidine-4,6-diamine |
| SMILES | CCN(c1ccccc1)c1cc(NCc2ccco2)ncn1 |
| InChI | InChI=1S/C17H18N4O/c1-2-21(14-7-4-3-5-8-14)17-11-16(19-13-20-17)18-12-15-9-6-10-22-15/h3-11,13H,2,12H2,1H3,(H,18,19,20) |
| InChIKey | VQXKDJGQTNDWEH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |