C15H30O4Si — CID 10935553
methyl (2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-oxohexanoate (PubChem CID 10935553) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is methyl (2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-oxohexanoate.
| Compound Name | methyl (2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-oxohexanoate |
|---|---|
| PubChem CID | 10935553 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | methyl (2R,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-oxohexanoate |
| SMILES | COC(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(C)=O |
| InChI | InChI=1S/C15H30O4Si/c1-10(12(3)16)13(11(2)14(17)18-7)19-20(8,9)15(4,5)6/h10-11,13H,1-9H3/t10-,11+,13-/m0/s1 |
| InChIKey | HMPPHORRPDFVKH-LOWVWBTDSA-N |
| XLogP | 3.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|