C19H16N2O2 — CID 10935596
N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2-(1H-indol-3-yl)-2-oxoacetamide (PubChem CID 10935596) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2-(1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2-(1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 10935596 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2-(1H-indol-3-yl)-2-oxoacetamide |
| SMILES | O=C(N[C@@H]1CCc2ccccc21)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H16N2O2/c22-18(15-11-20-16-8-4-3-7-14(15)16)19(23)21-17-10-9-12-5-1-2-6-13(12)17/h1-8,11,17,20H,9-10H2,(H,21,23)/t17-/m1/s1 |
| InChIKey | HPOOEGNMALNZJV-QGZVFWFLSA-N |
| XLogP | 3.15 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|