C19H28O3 — CID 10935607
[(1S,7S,8S,8aR)-7-methyl-8-(3-oxopropyl)-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate (PubChem CID 10935607) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is [(1S,7S,8S,8aR)-7-methyl-8-(3-oxopropyl)-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate.
| Compound Name | [(1S,7S,8S,8aR)-7-methyl-8-(3-oxopropyl)-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate |
|---|---|
| PubChem CID | 10935607 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | [(1S,7S,8S,8aR)-7-methyl-8-(3-oxopropyl)-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate |
| SMILES | CC[C@H](C)C(=O)O[C@H]1CCC=C2C=C[C@H](C)[C@H](CCC=O)[C@H]21 |
| InChI | InChI=1S/C19H28O3/c1-4-13(2)19(21)22-17-9-5-7-15-11-10-14(3)16(18(15)17)8-6-12-20/h7,10-14,16-18H,4-6,8-9H2,1-3H3/t13-,14-,16-,17-,18-/m0/s1 |
| InChIKey | LMVIPMDYVYNCMA-IAVJCBSLSA-N |
| XLogP | 4.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|