C14H22N4O2 — CID 109360386
2-methyl-N-(oxolan-2-ylmethyl)-6-(propan-2-ylamino)pyrimidine-4-carboxamide (PubChem CID 109360386) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-methyl-N-(oxolan-2-ylmethyl)-6-(propan-2-ylamino)pyrimidine-4-carboxamide.
| Compound Name | 2-methyl-N-(oxolan-2-ylmethyl)-6-(propan-2-ylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109360386 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-methyl-N-(oxolan-2-ylmethyl)-6-(propan-2-ylamino)pyrimidine-4-carboxamide |
| SMILES | Cc1nc(NC(C)C)cc(C(=O)NCC2CCCO2)n1 |
| InChI | InChI=1S/C14H22N4O2/c1-9(2)16-13-7-12(17-10(3)18-13)14(19)15-8-11-5-4-6-20-11/h7,9,11H,4-6,8H2,1-3H3,(H,15,19)(H,16,17,18) |
| InChIKey | PURRMRLPXDONPT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |