C18H19F3N4O2 — CID 109365945
2-methyl-N-(oxolan-2-ylmethyl)-6-[2-(trifluoromethyl)anilino]pyrimidine-4-carboxamide (PubChem CID 109365945) has the molecular formula C18H19F3N4O2 and a molecular weight of 380.37 g/mol. Its IUPAC name is 2-methyl-N-(oxolan-2-ylmethyl)-6-[2-(trifluoromethyl)anilino]pyrimidine-4-carboxamide.
| Compound Name | 2-methyl-N-(oxolan-2-ylmethyl)-6-[2-(trifluoromethyl)anilino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109365945 |
| Molecular Formula | C18H19F3N4O2 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-methyl-N-(oxolan-2-ylmethyl)-6-[2-(trifluoromethyl)anilino]pyrimidine-4-carboxamide |
| SMILES | Cc1nc(Nc2ccccc2C(F)(F)F)cc(C(=O)NCC2CCCO2)n1 |
| InChI | InChI=1S/C18H19F3N4O2/c1-11-23-15(17(26)22-10-12-5-4-8-27-12)9-16(24-11)25-14-7-3-2-6-13(14)18(19,20)21/h2-3,6-7,9,12H,4-5,8,10H2,1H3,(H,22,26)(H,23,24,25) |
| InChIKey | GKHSBMJSCNYCHV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |