C16H27N5O2 — CID 109362132
2-methyl-N-(2-methylpropyl)-6-(2-morpholin-4-ylethylamino)pyrimidine-4-carboxamide (PubChem CID 109362132) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 2-methyl-N-(2-methylpropyl)-6-(2-morpholin-4-ylethylamino)pyrimidine-4-carboxamide.
| Compound Name | 2-methyl-N-(2-methylpropyl)-6-(2-morpholin-4-ylethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109362132 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 2-methyl-N-(2-methylpropyl)-6-(2-morpholin-4-ylethylamino)pyrimidine-4-carboxamide |
| SMILES | Cc1nc(NCCN2CCOCC2)cc(C(=O)NCC(C)C)n1 |
| InChI | InChI=1S/C16H27N5O2/c1-12(2)11-18-16(22)14-10-15(20-13(3)19-14)17-4-5-21-6-8-23-9-7-21/h10,12H,4-9,11H2,1-3H3,(H,18,22)(H,17,19,20) |
| InChIKey | GNPHPCVXIPUEME-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |