C21H29N5O2 — CID 112852426
N-(2-methylpropyl)-6-(2-morpholin-4-ylethylamino)-2-phenylpyrimidine-4-carboxamide (PubChem CID 112852426) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is N-(2-methylpropyl)-6-(2-morpholin-4-ylethylamino)-2-phenylpyrimidine-4-carboxamide.
| Compound Name | N-(2-methylpropyl)-6-(2-morpholin-4-ylethylamino)-2-phenylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112852426 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | N-(2-methylpropyl)-6-(2-morpholin-4-ylethylamino)-2-phenylpyrimidine-4-carboxamide |
| SMILES | CC(C)CNC(=O)c1cc(NCCN2CCOCC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H29N5O2/c1-16(2)15-23-21(27)18-14-19(22-8-9-26-10-12-28-13-11-26)25-20(24-18)17-6-4-3-5-7-17/h3-7,14,16H,8-13,15H2,1-2H3,(H,23,27)(H,22,24,25) |
| InChIKey | UYMSXIAIKVZNLA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |