C18H32O3Si — CID 10936245
[(4S,4aR)-4-(methoxymethoxy)-3,3,4a-trimethyl-2,4,5,8-tetrahydronaphthalen-1-yl]oxy-trimethylsilane (PubChem CID 10936245) has the molecular formula C18H32O3Si and a molecular weight of 324.54 g/mol. Its IUPAC name is [(4S,4aR)-4-(methoxymethoxy)-3,3,4a-trimethyl-2,4,5,8-tetrahydronaphthalen-1-yl]oxy-trimethylsilane.
| Compound Name | [(4S,4aR)-4-(methoxymethoxy)-3,3,4a-trimethyl-2,4,5,8-tetrahydronaphthalen-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10936245 |
| Molecular Formula | C18H32O3Si |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | [(4S,4aR)-4-(methoxymethoxy)-3,3,4a-trimethyl-2,4,5,8-tetrahydronaphthalen-1-yl]oxy-trimethylsilane |
| SMILES | COCO[C@H]1C(C)(C)CC(O[Si](C)(C)C)=C2CC=CC[C@]21C |
| InChI | InChI=1S/C18H32O3Si/c1-17(2)12-15(21-22(5,6)7)14-10-8-9-11-18(14,3)16(17)20-13-19-4/h8-9,16H,10-13H2,1-7H3/t16-,18+/m0/s1 |
| InChIKey | KZIMJLOCLOTKJG-FUHWJXTLSA-N |
| XLogP | 4.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|