C19H34O5Si — CID 164681098
[(2S,3S,4aR,5S,8aR)-2,3-dimethoxy-2,3,5-trimethyl-6-prop-2-enyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-7-yl]oxy-trimethylsilane (PubChem CID 164681098) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is [(2S,3S,4aR,5S,8aR)-2,3-dimethoxy-2,3,5-trimethyl-6-prop-2-enyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-7-yl]oxy-trimethylsilane.
| Compound Name | [(2S,3S,4aR,5S,8aR)-2,3-dimethoxy-2,3,5-trimethyl-6-prop-2-enyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-7-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 164681098 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | [(2S,3S,4aR,5S,8aR)-2,3-dimethoxy-2,3,5-trimethyl-6-prop-2-enyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-7-yl]oxy-trimethylsilane |
| SMILES | C=CCC1=C(O[Si](C)(C)C)C[C@H]2O[C@](C)(OC)[C@@](C)(OC)O[C@@H]2[C@H]1C |
| InChI | InChI=1S/C19H34O5Si/c1-10-11-14-13(2)17-16(12-15(14)24-25(7,8)9)22-18(3,20-5)19(4,21-6)23-17/h10,13,16-17H,1,11-12H2,2-9H3/t13-,16+,17+,18-,19-/m0/s1 |
| InChIKey | XOLJNQVDSZFLBF-LRMKFPBYSA-N |
| XLogP | 4.22 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|