C16H30O5Si — CID 164681097
[(2S,3S,4aR,5S,8aR)-2,3-dimethoxy-2,3,5-trimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-7-yl]oxy-trimethylsilane (PubChem CID 164681097) has the molecular formula C16H30O5Si and a molecular weight of 330.50 g/mol. Its IUPAC name is [(2S,3S,4aR,5S,8aR)-2,3-dimethoxy-2,3,5-trimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-7-yl]oxy-trimethylsilane.
| Compound Name | [(2S,3S,4aR,5S,8aR)-2,3-dimethoxy-2,3,5-trimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-7-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 164681097 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | [(2S,3S,4aR,5S,8aR)-2,3-dimethoxy-2,3,5-trimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-7-yl]oxy-trimethylsilane |
| SMILES | CO[C@@]1(C)O[C@@H]2[C@@H](C)C=C(O[Si](C)(C)C)C[C@H]2O[C@]1(C)OC |
| InChI | InChI=1S/C16H30O5Si/c1-11-9-12(21-22(6,7)8)10-13-14(11)20-16(3,18-5)15(2,17-4)19-13/h9,11,13-14H,10H2,1-8H3/t11-,13+,14+,15-,16-/m0/s1 |
| InChIKey | HQQAXVKCXHJZIV-AMMHQNNLSA-N |
| XLogP | 3.27 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|