C16H30O3Si — CID 14811208
[(3aR,7R,7aS)-2,2,7-trimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 14811208) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is [(3aR,7R,7aS)-2,2,7-trimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,7R,7aS)-2,2,7-trimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 14811208 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | [(3aR,7R,7aS)-2,2,7-trimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@@H]1C=C(O[Si](C)(C)C(C)(C)C)C[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C16H30O3Si/c1-11-9-12(19-20(7,8)15(2,3)4)10-13-14(11)18-16(5,6)17-13/h9,11,13-14H,10H2,1-8H3/t11-,13-,14+/m1/s1 |
| InChIKey | DQXMNEVIOPNEOU-BNOWGMLFSA-N |
| XLogP | 4.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|