C17H18F2N4O — CID 109363428
N-cyclopentyl-6-(3,4-difluoroanilino)-2-methylpyrimidine-4-carboxamide (PubChem CID 109363428) has the molecular formula C17H18F2N4O and a molecular weight of 332.35 g/mol. Its IUPAC name is N-cyclopentyl-6-(3,4-difluoroanilino)-2-methylpyrimidine-4-carboxamide.
| Compound Name | N-cyclopentyl-6-(3,4-difluoroanilino)-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109363428 |
| Molecular Formula | C17H18F2N4O |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N-cyclopentyl-6-(3,4-difluoroanilino)-2-methylpyrimidine-4-carboxamide |
| SMILES | Cc1nc(Nc2ccc(F)c(F)c2)cc(C(=O)NC2CCCC2)n1 |
| InChI | InChI=1S/C17H18F2N4O/c1-10-20-15(17(24)23-11-4-2-3-5-11)9-16(21-10)22-12-6-7-13(18)14(19)8-12/h6-9,11H,2-5H2,1H3,(H,23,24)(H,20,21,22) |
| InChIKey | HRHUXGUXLIOSIV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |