C18H11F5N4O — CID 112851218
6-(3,4-difluoroanilino)-2-methyl-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide (PubChem CID 112851218) has the molecular formula C18H11F5N4O and a molecular weight of 394.30 g/mol. Its IUPAC name is 6-(3,4-difluoroanilino)-2-methyl-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide.
| Compound Name | 6-(3,4-difluoroanilino)-2-methyl-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 112851218 |
| Molecular Formula | C18H11F5N4O |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 6-(3,4-difluoroanilino)-2-methyl-N-(2,3,4-trifluorophenyl)pyrimidine-4-carboxamide |
| SMILES | Cc1nc(Nc2ccc(F)c(F)c2)cc(C(=O)Nc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C18H11F5N4O/c1-8-24-14(18(28)27-13-5-4-11(20)16(22)17(13)23)7-15(25-8)26-9-2-3-10(19)12(21)6-9/h2-7H,1H3,(H,27,28)(H,24,25,26) |
| InChIKey | MRYNQBCQQCXTCU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|