C19H23FN4O — CID 109363792
6-(cyclohexylamino)-N-[(2-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide (PubChem CID 109363792) has the molecular formula C19H23FN4O and a molecular weight of 342.42 g/mol. Its IUPAC name is 6-(cyclohexylamino)-N-[(2-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide.
| Compound Name | 6-(cyclohexylamino)-N-[(2-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109363792 |
| Molecular Formula | C19H23FN4O |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 6-(cyclohexylamino)-N-[(2-fluorophenyl)methyl]-2-methylpyrimidine-4-carboxamide |
| SMILES | Cc1nc(NC2CCCCC2)cc(C(=O)NCc2ccccc2F)n1 |
| InChI | InChI=1S/C19H23FN4O/c1-13-22-17(11-18(23-13)24-15-8-3-2-4-9-15)19(25)21-12-14-7-5-6-10-16(14)20/h5-7,10-11,15H,2-4,8-9,12H2,1H3,(H,21,25)(H,22,23,24) |
| InChIKey | VGGHFUCSWUMAOE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |