C21H27FN4O — CID 109371830
6-(cycloheptylamino)-N-[2-(2-fluorophenyl)ethyl]-2-methylpyrimidine-4-carboxamide (PubChem CID 109371830) has the molecular formula C21H27FN4O and a molecular weight of 370.47 g/mol. Its IUPAC name is 6-(cycloheptylamino)-N-[2-(2-fluorophenyl)ethyl]-2-methylpyrimidine-4-carboxamide.
| Compound Name | 6-(cycloheptylamino)-N-[2-(2-fluorophenyl)ethyl]-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109371830 |
| Molecular Formula | C21H27FN4O |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 6-(cycloheptylamino)-N-[2-(2-fluorophenyl)ethyl]-2-methylpyrimidine-4-carboxamide |
| SMILES | Cc1nc(NC2CCCCCC2)cc(C(=O)NCCc2ccccc2F)n1 |
| InChI | InChI=1S/C21H27FN4O/c1-15-24-19(14-20(25-15)26-17-9-4-2-3-5-10-17)21(27)23-13-12-16-8-6-7-11-18(16)22/h6-8,11,14,17H,2-5,9-10,12-13H2,1H3,(H,23,27)(H,24,25,26) |
| InChIKey | RIWDLPKCNDWGGQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |