C16H17F3N4O2 — CID 109364749
6-(2-methoxyethylamino)-2-methyl-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide (PubChem CID 109364749) has the molecular formula C16H17F3N4O2 and a molecular weight of 354.33 g/mol. Its IUPAC name is 6-(2-methoxyethylamino)-2-methyl-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(2-methoxyethylamino)-2-methyl-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109364749 |
| Molecular Formula | C16H17F3N4O2 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 6-(2-methoxyethylamino)-2-methyl-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
| SMILES | COCCNc1cc(C(=O)Nc2ccc(C(F)(F)F)cc2)nc(C)n1 |
| InChI | InChI=1S/C16H17F3N4O2/c1-10-21-13(9-14(22-10)20-7-8-25-2)15(24)23-12-5-3-11(4-6-12)16(17,18)19/h3-6,9H,7-8H2,1-2H3,(H,23,24)(H,20,21,22) |
| InChIKey | SFTBLGQZPCAWKV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|