C15H16F2N4O2 — CID 109364780
N-(2,4-difluorophenyl)-6-(2-methoxyethylamino)-2-methylpyrimidine-4-carboxamide (PubChem CID 109364780) has the molecular formula C15H16F2N4O2 and a molecular weight of 322.32 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-6-(2-methoxyethylamino)-2-methylpyrimidine-4-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-6-(2-methoxyethylamino)-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109364780 |
| Molecular Formula | C15H16F2N4O2 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N-(2,4-difluorophenyl)-6-(2-methoxyethylamino)-2-methylpyrimidine-4-carboxamide |
| SMILES | COCCNc1cc(C(=O)Nc2ccc(F)cc2F)nc(C)n1 |
| InChI | InChI=1S/C15H16F2N4O2/c1-9-19-13(8-14(20-9)18-5-6-23-2)15(22)21-12-4-3-10(16)7-11(12)17/h3-4,7-8H,5-6H2,1-2H3,(H,21,22)(H,18,19,20) |
| InChIKey | JRQRUAHVOCOEEL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|