C16H18F2N4O2 — CID 109365139
N-(2,4-difluorophenyl)-6-(3-methoxypropylamino)-2-methylpyrimidine-4-carboxamide (PubChem CID 109365139) has the molecular formula C16H18F2N4O2 and a molecular weight of 336.34 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-6-(3-methoxypropylamino)-2-methylpyrimidine-4-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-6-(3-methoxypropylamino)-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109365139 |
| Molecular Formula | C16H18F2N4O2 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-(2,4-difluorophenyl)-6-(3-methoxypropylamino)-2-methylpyrimidine-4-carboxamide |
| SMILES | COCCCNc1cc(C(=O)Nc2ccc(F)cc2F)nc(C)n1 |
| InChI | InChI=1S/C16H18F2N4O2/c1-10-20-14(9-15(21-10)19-6-3-7-24-2)16(23)22-13-5-4-11(17)8-12(13)18/h4-5,8-9H,3,6-7H2,1-2H3,(H,22,23)(H,19,20,21) |
| InChIKey | CYMLEDIIRUDMCL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|