C16H27N5O2 — CID 109364994
(4-ethylpiperazin-1-yl)-[6-(3-methoxypropylamino)-2-methylpyrimidin-4-yl]methanone (PubChem CID 109364994) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-[6-(3-methoxypropylamino)-2-methylpyrimidin-4-yl]methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-[6-(3-methoxypropylamino)-2-methylpyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 109364994 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-[6-(3-methoxypropylamino)-2-methylpyrimidin-4-yl]methanone |
| SMILES | CCN1CCN(C(=O)c2cc(NCCCOC)nc(C)n2)CC1 |
| InChI | InChI=1S/C16H27N5O2/c1-4-20-7-9-21(10-8-20)16(22)14-12-15(19-13(2)18-14)17-6-5-11-23-3/h12H,4-11H2,1-3H3,(H,17,18,19) |
| InChIKey | FBZNTVZEPROHBQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|