C17H27N5O4 — CID 109365034
ethyl 4-[6-(3-methoxypropylamino)-2-methylpyrimidine-4-carbonyl]piperazine-1-carboxylate (PubChem CID 109365034) has the molecular formula C17H27N5O4 and a molecular weight of 365.43 g/mol. Its IUPAC name is ethyl 4-[6-(3-methoxypropylamino)-2-methylpyrimidine-4-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-(3-methoxypropylamino)-2-methylpyrimidine-4-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109365034 |
| Molecular Formula | C17H27N5O4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | ethyl 4-[6-(3-methoxypropylamino)-2-methylpyrimidine-4-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2cc(NCCCOC)nc(C)n2)CC1 |
| InChI | InChI=1S/C17H27N5O4/c1-4-26-17(24)22-9-7-21(8-10-22)16(23)14-12-15(20-13(2)19-14)18-6-5-11-25-3/h12H,4-11H2,1-3H3,(H,18,19,20) |
| InChIKey | LVBYFWBFXCONEE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|