C18H29N5O3 — CID 109361602
ethyl 4-[[6-(butylamino)-2-methylpyrimidine-4-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 109361602) has the molecular formula C18H29N5O3 and a molecular weight of 363.46 g/mol. Its IUPAC name is ethyl 4-[[6-(butylamino)-2-methylpyrimidine-4-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[6-(butylamino)-2-methylpyrimidine-4-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109361602 |
| Molecular Formula | C18H29N5O3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | ethyl 4-[[6-(butylamino)-2-methylpyrimidine-4-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCCCNc1cc(C(=O)NC2CCN(C(=O)OCC)CC2)nc(C)n1 |
| InChI | InChI=1S/C18H29N5O3/c1-4-6-9-19-16-12-15(20-13(3)21-16)17(24)22-14-7-10-23(11-8-14)18(25)26-5-2/h12,14H,4-11H2,1-3H3,(H,22,24)(H,19,20,21) |
| InChIKey | VCBFUUKXJSGEOY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|