C17H27N5O3 — CID 109340250
ethyl 4-[[6-(2-methylpropylamino)pyrimidine-4-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 109340250) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is ethyl 4-[[6-(2-methylpropylamino)pyrimidine-4-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[6-(2-methylpropylamino)pyrimidine-4-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109340250 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | ethyl 4-[[6-(2-methylpropylamino)pyrimidine-4-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2cc(NCC(C)C)ncn2)CC1 |
| InChI | InChI=1S/C17H27N5O3/c1-4-25-17(24)22-7-5-13(6-8-22)21-16(23)14-9-15(20-11-19-14)18-10-12(2)3/h9,11-13H,4-8,10H2,1-3H3,(H,21,23)(H,18,19,20) |
| InChIKey | MXAFHHULTUAUOG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |