C20H25N5O4 — CID 109352783
ethyl 4-[[6-(3-methoxyanilino)pyrimidine-4-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 109352783) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is ethyl 4-[[6-(3-methoxyanilino)pyrimidine-4-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[6-(3-methoxyanilino)pyrimidine-4-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109352783 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | ethyl 4-[[6-(3-methoxyanilino)pyrimidine-4-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2cc(Nc3cccc(OC)c3)ncn2)CC1 |
| InChI | InChI=1S/C20H25N5O4/c1-3-29-20(27)25-9-7-14(8-10-25)24-19(26)17-12-18(22-13-21-17)23-15-5-4-6-16(11-15)28-2/h4-6,11-14H,3,7-10H2,1-2H3,(H,24,26)(H,21,22,23) |
| InChIKey | BTDFCVAALLHKOV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |