C17H18O5S — CID 10936544
methyl 2-[5-(benzenesulfonyl)cyclohexa-2,4-dien-1-yl]-3-oxobutanoate (PubChem CID 10936544) has the molecular formula C17H18O5S and a molecular weight of 334.39 g/mol. Its IUPAC name is methyl 2-[5-(benzenesulfonyl)cyclohexa-2,4-dien-1-yl]-3-oxobutanoate.
| Compound Name | methyl 2-[5-(benzenesulfonyl)cyclohexa-2,4-dien-1-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 10936544 |
| Molecular Formula | C17H18O5S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | methyl 2-[5-(benzenesulfonyl)cyclohexa-2,4-dien-1-yl]-3-oxobutanoate |
| SMILES | COC(=O)C(C(C)=O)C1C=CC=C(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C17H18O5S/c1-12(18)16(17(19)22-2)13-7-6-10-15(11-13)23(20,21)14-8-4-3-5-9-14/h3-10,13,16H,11H2,1-2H3 |
| InChIKey | BPJSVNOYOQVIFX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|