C19H19ClN4O2 — CID 109367979
N-[2-(3-chlorophenyl)ethyl]-6-(furan-2-ylmethylamino)-2-methylpyrimidine-4-carboxamide (PubChem CID 109367979) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-6-(furan-2-ylmethylamino)-2-methylpyrimidine-4-carboxamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-6-(furan-2-ylmethylamino)-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109367979 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-6-(furan-2-ylmethylamino)-2-methylpyrimidine-4-carboxamide |
| SMILES | Cc1nc(NCc2ccco2)cc(C(=O)NCCc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C19H19ClN4O2/c1-13-23-17(11-18(24-13)22-12-16-6-3-9-26-16)19(25)21-8-7-14-4-2-5-15(20)10-14/h2-6,9-11H,7-8,12H2,1H3,(H,21,25)(H,22,23,24) |
| InChIKey | NDHRYVZQCWOIDF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |