C20H20ClN5O — CID 109371357
6-[2-(3-chlorophenyl)ethylamino]-2-methyl-N-(pyridin-4-ylmethyl)pyrimidine-4-carboxamide (PubChem CID 109371357) has the molecular formula C20H20ClN5O and a molecular weight of 381.87 g/mol. Its IUPAC name is 6-[2-(3-chlorophenyl)ethylamino]-2-methyl-N-(pyridin-4-ylmethyl)pyrimidine-4-carboxamide.
| Compound Name | 6-[2-(3-chlorophenyl)ethylamino]-2-methyl-N-(pyridin-4-ylmethyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109371357 |
| Molecular Formula | C20H20ClN5O |
| Molecular Weight | 381.87 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 6-[2-(3-chlorophenyl)ethylamino]-2-methyl-N-(pyridin-4-ylmethyl)pyrimidine-4-carboxamide |
| SMILES | Cc1nc(NCCc2cccc(Cl)c2)cc(C(=O)NCc2ccncc2)n1 |
| InChI | InChI=1S/C20H20ClN5O/c1-14-25-18(20(27)24-13-16-5-8-22-9-6-16)12-19(26-14)23-10-7-15-3-2-4-17(21)11-15/h2-6,8-9,11-12H,7,10,13H2,1H3,(H,24,27)(H,23,25,26) |
| InChIKey | KJHPZLXJAUXGSK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.87 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |