C16H18F2N4O — CID 109373516
6-(2,6-difluoroanilino)-N,N-diethyl-2-methylpyrimidine-4-carboxamide (PubChem CID 109373516) has the molecular formula C16H18F2N4O and a molecular weight of 320.34 g/mol. Its IUPAC name is 6-(2,6-difluoroanilino)-N,N-diethyl-2-methylpyrimidine-4-carboxamide.
| Compound Name | 6-(2,6-difluoroanilino)-N,N-diethyl-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109373516 |
| Molecular Formula | C16H18F2N4O |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 6-(2,6-difluoroanilino)-N,N-diethyl-2-methylpyrimidine-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(Nc2c(F)cccc2F)nc(C)n1 |
| InChI | InChI=1S/C16H18F2N4O/c1-4-22(5-2)16(23)13-9-14(20-10(3)19-13)21-15-11(17)7-6-8-12(15)18/h6-9H,4-5H2,1-3H3,(H,19,20,21) |
| InChIKey | UFBCUOJIPLVLEP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |