C17H31F3N4O2 — CID 109376525
N'-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109376525) has the molecular formula C17H31F3N4O2 and a molecular weight of 380.46 g/mol. Its IUPAC name is N'-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109376525 |
| Molecular Formula | C17H31F3N4O2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | N'-methyl-N-[3-(oxolan-3-ylmethoxy)propyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCOCC1CCOC1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H31F3N4O2/c1-14(17(18,19)20)23-6-8-24(9-7-23)16(21-2)22-5-3-10-25-12-15-4-11-26-13-15/h14-15H,3-13H2,1-2H3,(H,21,22) |
| InChIKey | DQNBXENXWSSEBQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|