C16H29F3N4O2 — CID 109376893
N-ethyl-N'-[(4-hydroxyoxan-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109376893) has the molecular formula C16H29F3N4O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is N-ethyl-N'-[(4-hydroxyoxan-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(4-hydroxyoxan-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109376893 |
| Molecular Formula | C16H29F3N4O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | N-ethyl-N'-[(4-hydroxyoxan-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(O)CCOCC1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H29F3N4O2/c1-3-20-14(21-12-15(24)4-10-25-11-5-15)23-8-6-22(7-9-23)13(2)16(17,18)19/h13,24H,3-12H2,1-2H3,(H,20,21) |
| InChIKey | VCZBNWNSQBRONO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|