C17H32F3IN4O2 — CID 109379049
N-ethyl-N'-[(4-methoxyoxan-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109379049) has the molecular formula C17H32F3IN4O2 and a molecular weight of 508.37 g/mol. Its IUPAC name is N-ethyl-N'-[(4-methoxyoxan-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[(4-methoxyoxan-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109379049 |
| Molecular Formula | C17H32F3IN4O2 |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | N-ethyl-N'-[(4-methoxyoxan-4-yl)methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(OC)CCOCC1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C17H31F3N4O2.HI/c1-4-21-15(22-13-16(25-3)5-11-26-12-6-16)24-9-7-23(8-10-24)14(2)17(18,19)20;/h14H,4-13H2,1-3H3,(H,21,22);1H |
| InChIKey | PQQXQFPNQUGHRV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|