C17H32F3IN4OS — CID 109377478
N-[(4-ethylsulfanyloxan-4-yl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109377478) has the molecular formula C17H32F3IN4OS and a molecular weight of 524.44 g/mol. Its IUPAC name is N-[(4-ethylsulfanyloxan-4-yl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(4-ethylsulfanyloxan-4-yl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109377478 |
| Molecular Formula | C17H32F3IN4OS |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | N-[(4-ethylsulfanyloxan-4-yl)methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCSC1(CN/C(=N\C)N2CCN(C(C)C(F)(F)F)CC2)CCOCC1.I |
| InChI | InChI=1S/C17H31F3N4OS.HI/c1-4-26-16(5-11-25-12-6-16)13-22-15(21-3)24-9-7-23(8-10-24)14(2)17(18,19)20;/h14H,4-13H2,1-3H3,(H,21,22);1H |
| InChIKey | GFAGJXBMSCDJJR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|