C21H30ClF3N4O — CID 109377637
N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109377637) has the molecular formula C21H30ClF3N4O and a molecular weight of 446.95 g/mol. Its IUPAC name is N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109377637 |
| Molecular Formula | C21H30ClF3N4O |
| Molecular Weight | 446.95 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-N'-methyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1(c2cccc(Cl)c2)CCOCC1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H30ClF3N4O/c1-16(21(23,24)25)28-8-10-29(11-9-28)19(26-2)27-15-20(6-12-30-13-7-20)17-4-3-5-18(22)14-17/h3-5,14,16H,6-13,15H2,1-2H3,(H,26,27) |
| InChIKey | GOAWCNLBBRBXPJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.95 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|