C22H30ClN5O — CID 111742343
N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide (PubChem CID 111742343) has the molecular formula C22H30ClN5O and a molecular weight of 415.97 g/mol. Its IUPAC name is N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide.
| Compound Name | N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111742343 |
| Molecular Formula | C22H30ClN5O |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCC1(c2cccc(Cl)c2)CCOCC1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C22H30ClN5O/c1-24-21(28-9-6-17(15-28)18-13-26-27(2)14-18)25-16-22(7-10-29-11-8-22)19-4-3-5-20(23)12-19/h3-5,12-14,17H,6-11,15-16H2,1-2H3,(H,24,25) |
| InChIKey | XMWDEYZGQMOELY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|