C17H22FN5 — CID 111741787
N-[(3-fluorophenyl)methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide (PubChem CID 111741787) has the molecular formula C17H22FN5 and a molecular weight of 315.40 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111741787 |
| Molecular Formula | C17H22FN5 |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cccc(F)c1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C17H22FN5/c1-19-17(20-9-13-4-3-5-16(18)8-13)23-7-6-14(12-23)15-10-21-22(2)11-15/h3-5,8,10-11,14H,6-7,9,12H2,1-2H3,(H,19,20) |
| InChIKey | IKKYNZKLLRVFIT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|