C19H24F3N5O — CID 111742747
N'-methyl-3-(1-methylpyrazol-4-yl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 111742747) has the molecular formula C19H24F3N5O and a molecular weight of 395.43 g/mol. Its IUPAC name is N'-methyl-3-(1-methylpyrazol-4-yl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-3-(1-methylpyrazol-4-yl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111742747 |
| Molecular Formula | C19H24F3N5O |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N'-methyl-3-(1-methylpyrazol-4-yl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1cccc(OCC(F)(F)F)c1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C19H24F3N5O/c1-23-18(27-7-6-15(12-27)16-10-25-26(2)11-16)24-9-14-4-3-5-17(8-14)28-13-19(20,21)22/h3-5,8,10-11,15H,6-7,9,12-13H2,1-2H3,(H,23,24) |
| InChIKey | KSTBUDZMHKFDDE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|